CAS 100874-09-7 appears in our catalog under these names: 6-Bromo-2-ethyl-1H-benzo(de)isoquinoline-1,3(2H)-dione, 95-<97%, 6–Bromo–2–ethyl–1H–benzo(de)isoquinoline–1,3(2H)–dione. Offered by: Hoffman Fine Chemicals, GLPBio. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg, 250mg.
6-bromo-2-ethylbenzo[de]isoquinoline-1,3-dione (CAS 100874-09-7) is a chemical compound with the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. IUPAC name: 6-bromo-2-ethylbenzo[de]isoquinoline-1,3-dione. InChIKey: WNFHOJUNEAHMPD-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO2 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 6-bromo-2-ethylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | WNFHOJUNEAHMPD-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C3C(=C(C=C2)Br)C=CC=C3C1=O |
Computed by PubChem (NCBI)