CAS 728-21-2 is the registry number for 5-Bromo-3-(4-methoxyphenyl)benzo[c]isoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-(4-methoxyphenyl)-2,1-benzoxazole (CAS 728-21-2) is a chemical compound with the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. IUPAC name: 5-bromo-3-(4-methoxyphenyl)-2,1-benzoxazole. InChIKey: LIEUUAXXKPVLMY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO2 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 5-bromo-3-(4-methoxyphenyl)-2,1-benzoxazole |
| InChIKey | LIEUUAXXKPVLMY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C3C=C(C=CC3=NO2)Br |
Computed by PubChem (NCBI)