CAS 1347814-83-8 is the registry number for 5-Bromo-2-(4-methoxyphenyl)furo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-(4-methoxyphenyl)furo[2,3-b]pyridine (CAS 1347814-83-8) is a chemical compound with the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. IUPAC name: 5-bromo-2-(4-methoxyphenyl)furo[2,3-b]pyridine. InChIKey: WWILJVHMJKXSCO-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO2 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 5-bromo-2-(4-methoxyphenyl)furo[2,3-b]pyridine |
| InChIKey | WWILJVHMJKXSCO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=CC(=CN=C3O2)Br |
Computed by PubChem (NCBI)