4-(4-Chlorophenyl)-2,6-diphenylpyrimidine, 97%
cas: 919301-53-4 — see every product listed under this CAS number, including other names
4-(4-Chlorophenyl)-2,6-diphenylpyrimidine, 97% (CAS 919301-53-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F053934-1G |
| cas | 919301-53-4 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 25g | 732.05 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 259.12 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1666.44 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 506.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 275.48 Pln | |
| BLDpharm | 25g | 530.95 Pln | |
| BLDpharm | 100g | 1791.62 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(4-chlorophenyl)-2,6-diphenylpyrimidine (CAS 919301-53-4) is a chemical compound with the molecular formula C22H15ClN2 and a molecular weight of 342.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,6-diphenylpyrimidine. InChIKey: AJSOWJLBAVMDJX-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,6-diphenylpyrimidine |
| InChIKey | AJSOWJLBAVMDJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)