CAS 881428-73-5 is the registry number for 4-(4-Chlorophenyl)-3,6-diphenylpyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-chlorophenyl)-3,6-diphenylpyridazine (CAS 881428-73-5) is a chemical compound with the molecular formula C22H15ClN2 and a molecular weight of 342.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-3,6-diphenylpyridazine. InChIKey: DXKULKZIYPMLOZ-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3,6-diphenylpyridazine |
| InChIKey | DXKULKZIYPMLOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(C(=C2)C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)