Products 919301-51-2
CAS 919301-51-2 is the registry number for 2-(3-Chlorophenyl)-4,6-diphenylpyrimidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(3-chlorophenyl)-4,6-diphenylpyrimidine (CAS 919301-51-2) is a chemical compound with the molecular formula C22H15ClN2 and a molecular weight of 342.8 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,6-diphenylpyrimidine. InChIKey: BHJFLOOHSMTNSJ-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,6-diphenylpyrimidine |
| InChIKey | BHJFLOOHSMTNSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC(=CC=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)