CAS 919301-53-4 appears in our catalog under these names: 4-(4-Chlorophenyl)-2,6-diphenylpyrimidine 97%, 4-(4-Chlorophenyl)-2,6-diphenylpyrimidine, 97%, 4-(4-Chlorophenyl)-2,6-diphenylpyrimidine, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-(4-chlorophenyl)-2,6-diphenylpyrimidine (CAS 919301-53-4) is a chemical compound with the molecular formula C22H15ClN2 and a molecular weight of 342.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,6-diphenylpyrimidine. InChIKey: AJSOWJLBAVMDJX-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,6-diphenylpyrimidine |
| InChIKey | AJSOWJLBAVMDJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)