Products 1536209-87-6
CAS 1536209-87-6 appears in our catalog under these names: 4–(3–Chlorophenyl)–2,6–diphenylpyrimidine, 4-(3-Chlorophenyl)-2,6-diphenylpyrimidine, >98.0%(HPLC)(N), 4-(3-Chlorophenyl)-2,6-diphenylpyrimidine 98+%, 4-(3-Chlorophenyl)-2,6-diphenylpyrimidine, 98+%, 98+%, 4-(3-CHLOROPHENYL)-2,6-DIPHENYLPYRIMIDINE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
4-(3-chlorophenyl)-2,6-diphenylpyrimidine (CAS 1536209-87-6) is a chemical compound with the molecular formula C22H15ClN2 and a molecular weight of 342.8 g/mol. IUPAC name: 4-(3-chlorophenyl)-2,6-diphenylpyrimidine. InChIKey: FDTRHTNHPKRWFG-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-2,6-diphenylpyrimidine |
| InChIKey | FDTRHTNHPKRWFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)