4-(4-Fluorophenyl)phenylboronic acid 97%
cas: 140369-67-1 — see every product listed under this CAS number, including other names
4-(4-Fluorophenyl)phenylboronic acid 97% (CAS 140369-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188245-250mg |
| cas | 140369-67-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 726.38 Pln | |
| Ambeed | 25g | 2662.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A188245 |
[4-(4-fluorophenyl)phenyl]boronic acid (CAS 140369-67-1) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(4-fluorophenyl)phenyl]boronic acid. InChIKey: KHMFYFVXTICBEL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [4-(4-fluorophenyl)phenyl]boronic acid |
| InChIKey | KHMFYFVXTICBEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[4-(4-fluorophenyl)phenyl]boronic acid, 4-(4-Fluorophenyl)phenylboronicAcid, (4'-fluoro-[1,1'-biphenyl]-4-yl)boronic acid, 4'-Fluorobiphenyl-4-boronic acid, Boronic acid, B-(4'-fluoro[1,1'-biphenyl]-4-yl)-, 4'-fluorobiphenyl-4-ylboronic acid, CALCIUMMETHOXYETHOXIDE, (4'-fluoro-[1,1'-biph, (4'-Fluoro[1,1'-biphenyl]-4-yl)boronic acid, 4-(4-Fluorophenyl)benzeneboronic acid (contains varying amounts of Anhydride)