(4-(4-Fluorophenyl)phenyl)boronic acid, ≥97-<99%
cas: 140369-67-1 — see every product listed under this CAS number, including other names
(4-(4-Fluorophenyl)phenyl)boronic acid, ≥97-<99% (CAS 140369-67-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC478-97-99-25g |
| cas | 140369-67-1 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 6796.46 Pln | |
| Hoffman Fine Chemicals | 50g | 10681.88 Pln | |
| Hoffman Fine Chemicals | 100g | 16902.38 Pln | |
| Hoffman Fine Chemicals | 200g | 26867.94 Pln | |
| Hoffman Fine Chemicals | 300g | 36163.60 Pln | |
| Hoffman Fine Chemicals | 400g | 43334.72 Pln |
properties
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
[4-(4-fluorophenyl)phenyl]boronic acid (CAS 140369-67-1) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(4-fluorophenyl)phenyl]boronic acid. InChIKey: KHMFYFVXTICBEL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [4-(4-fluorophenyl)phenyl]boronic acid |
| InChIKey | KHMFYFVXTICBEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[4-(4-fluorophenyl)phenyl]boronic acid, 4-(4-Fluorophenyl)phenylboronicAcid, (4'-fluoro-[1,1'-biphenyl]-4-yl)boronic acid, 4'-Fluorobiphenyl-4-boronic acid, Boronic acid, B-(4'-fluoro[1,1'-biphenyl]-4-yl)-, 4'-fluorobiphenyl-4-ylboronic acid, CALCIUMMETHOXYETHOXIDE, (4'-fluoro-[1,1'-biph, (4'-Fluoro[1,1'-biphenyl]-4-yl)boronic acid, 4-(4-Fluorophenyl)benzeneboronic acid (contains varying amounts of Anhydride)