Products 140369-67-1
CAS 140369-67-1 appears in our catalog under these names: 4-(4-Fluorophenyl)phenylboronic acid, 98%, (4-(4-Fluorophenyl)phenyl)boronic acid, 95-<97%, (4-(4-Fluorophenyl)phenyl)boronic acid, ≥97-<99%, 4–(4–Fluorophenyl)benzeneboronic acid (contains varying amounts of Anhydride), 4-(4-Fluorophenyl)phenylboronic acid 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 200g, 300g.
[4-(4-fluorophenyl)phenyl]boronic acid (CAS 140369-67-1) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: [4-(4-fluorophenyl)phenyl]boronic acid. InChIKey: KHMFYFVXTICBEL-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | [4-(4-fluorophenyl)phenyl]boronic acid |
| InChIKey | KHMFYFVXTICBEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[4-(4-fluorophenyl)phenyl]boronic acid, 4-(4-Fluorophenyl)phenylboronicAcid, (4'-fluoro-[1,1'-biphenyl]-4-yl)boronic acid, 4'-Fluorobiphenyl-4-boronic acid, Boronic acid, B-(4'-fluoro[1,1'-biphenyl]-4-yl)-, 4'-fluorobiphenyl-4-ylboronic acid, CALCIUMMETHOXYETHOXIDE, (4'-fluoro-[1,1'-biph, (4'-Fluoro[1,1'-biphenyl]-4-yl)boronic acid, 4-(4-Fluorophenyl)benzeneboronic acid (contains varying amounts of Anhydride)