CAS 1383532-12-4 appears in our catalog under these names: 2-Fluoro-biphenyl-5-ylboronic acid, 95%, (6-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, ≥95%, ≥95%, 2-Fluoro-biphenyl-5-ylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(4-fluoro-3-phenylphenyl)boronic acid (CAS 1383532-12-4) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (4-fluoro-3-phenylphenyl)boronic acid. InChIKey: XQWCKGIOGSWPAE-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (4-fluoro-3-phenylphenyl)boronic acid |
| InChIKey | XQWCKGIOGSWPAE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)