cas: 419550-79-1 — see every product listed under this CAS number, including other names
4-(4-Methoxyphenyl)-5-methyl-1H-pyrazol-3-amine, 98% (CAS 419550-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A835643-1g |
| cas | 419550-79-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7263.55 Pln | |
| AmBeed | 5g | 29267.35 Pln | |
| AmBeed | 10g | 54148.57 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine (CAS 419550-79-1) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine. InChIKey: OGKYRTBDCGSONH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine |
| InChIKey | OGKYRTBDCGSONH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)