cas: 138330-01-5 — see every product listed under this CAS number, including other names
4-(4-Methylthiazol-2-yl)phenol, 98% (CAS 138330-01-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F747398-100MG |
| cas | 138330-01-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 500mg | 794.53 Pln | |
| Fluorochem | 1g | 1195.43 Pln | |
| Fluorochem | 2.5g | 2377.31 Pln | |
| Fluorochem | 5g | 3538.36 Pln | |
| Fluorochem | 10g | 5948.96 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-methyl-1,3-thiazol-2-yl)phenol (CAS 138330-01-5) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: 4-(4-methyl-1,3-thiazol-2-yl)phenol. InChIKey: KYCMBRIDHHFYQX-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | 4-(4-methyl-1,3-thiazol-2-yl)phenol |
| InChIKey | KYCMBRIDHHFYQX-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)