cas: 10389-51-2 — see every product listed under this CAS number, including other names
4-(4-Nitrophenyl)morpholine, 98%, 98% (CAS 10389-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144T3-1g |
| cas | 10389-51-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 381.20 Pln | |
| Chemat | 100g | 573.20 Pln | |
| Chemat | 250g | 1322.00 Pln | |
| Chemat | 500g | 2596.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-nitrophenyl)morpholine (CAS 10389-51-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(4-nitrophenyl)morpholine. InChIKey: IAJDSUYFELYZCS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)morpholine |
| InChIKey | IAJDSUYFELYZCS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)