4-(4-Nitrophenyl)quinoline, 95%
cas: 1447234-78-7 — see every product listed under this CAS number, including other names
4-(4-Nitrophenyl)quinoline, 95% (CAS 1447234-78-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1575223-250mg |
| cas | 1447234-78-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 625.36 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1341.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-nitrophenyl)quinoline (CAS 1447234-78-7) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 4-(4-nitrophenyl)quinoline. InChIKey: PMHDSQDSKJSXND-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 4-(4-nitrophenyl)quinoline |
| InChIKey | PMHDSQDSKJSXND-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(4-nitrophenyl)quinoline