4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid, 95%, 95%
cas: 855672-46-7 — see every product listed under this CAS number, including other names
4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid, 95%, 95% (CAS 855672-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AQM0-100mg |
| cas | 855672-46-7 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1077.20 Pln | |
| Chemat | 1g | 3112.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid (CAS 855672-46-7) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: AOEGVJNSAAVOLR-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | AOEGVJNSAAVOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)