Products 144451-54-7
CAS 144451-54-7 is the registry number for Methyl 2-cyano-3-(3-fluorophenyl)prop-2-enoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Methyl (E)-2-cyano-3-(3-fluorophenyl)prop-2-enoate (CAS 144451-54-7) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: methyl (E)-2-cyano-3-(3-fluorophenyl)prop-2-enoate. InChIKey: XNBTUEPNFFWRHE-WEVVVXLNSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | methyl (E)-2-cyano-3-(3-fluorophenyl)prop-2-enoate |
| InChIKey | XNBTUEPNFFWRHE-WEVVVXLNSA-N |
| SMILES | COC(=O)/C(=C/C1=CC(=CC=C1)F)/C#N |
Computed by PubChem (NCBI)