CAS 869496-66-2 is the registry number for 3-(4-Fluorophenyl)-5-methylisoxazole-4-carboxaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde (CAS 869496-66-2) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde. InChIKey: GKFSKVZRERHBQP-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde |
| InChIKey | GKFSKVZRERHBQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C=O |
Computed by PubChem (NCBI)