CAS 364758-55-4 is the registry number for 6-(4-Fluorophenoxy)pyridin-3-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-(4-fluorophenoxy)pyridin-3-ol (CAS 364758-55-4) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 6-(4-fluorophenoxy)pyridin-3-ol. InChIKey: ISISINCVBHRXTL-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 6-(4-fluorophenoxy)pyridin-3-ol |
| InChIKey | ISISINCVBHRXTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=NC=C(C=C2)O)F |
Computed by PubChem (NCBI)