Products 855672-46-7
CAS 855672-46-7 appears in our catalog under these names: 4-(4-Fluorophenyl)-1h-pyrrole-2-carboxylic acid, 95%, 4-(4-Fluorophenyl)-1H-pyrrole-2-carboxylic acid, 4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g, 100mg.
4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid (CAS 855672-46-7) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: AOEGVJNSAAVOLR-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | AOEGVJNSAAVOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)