cas: 73120-67-9 — see every product listed under this CAS number, including other names
4-(4-isobutylphenyl)-4-oxobutanoic acid, 95%, 95% (CAS 73120-67-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VTY1-50mg |
| cas | 73120-67-9 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1005.20 Pln | |
| Chemat | 100mg | 1466.00 Pln | |
| Chemat | 250mg | 2075.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid (CAS 73120-67-9) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid. InChIKey: VTSCHNAWJCRJJG-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid |
| InChIKey | VTSCHNAWJCRJJG-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)