CAS 73120-67-9 appears in our catalog under these names: 4-(4-Isobutylphenyl)-4-oxobutanoic acid, 95%, 4-(4-Isobutylphenyl)-4-oxobutanoic acid, 97%, 4–(4–isobutylphenyl)–4–oxobutanoic acid, 4-(4-(2-Methylpropyl)phenyl)-4-oxobutanoic acid, 4-(4-isobutylphenyl)-4-oxobutanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg.
4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid (CAS 73120-67-9) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid. InChIKey: VTSCHNAWJCRJJG-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid |
| InChIKey | VTSCHNAWJCRJJG-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)