Products 59313-58-5
CAS 59313-58-5 appears in our catalog under these names: oxiran-2-ylmethyl 4-tert-butylbenzoate, 95%, Glycidyl 4–tert–Butylbenzoate, Glycidyl 4-tert-Butylbenzoate, >90.0%(GC), Glycidyl 4-tert-butylbenzoate, 90%, 90%, Oxiran-2-ylmethyl 4-(tert-butyl)benzoate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Oxiran-2-ylmethyl 4-tert-butylbenzoate (CAS 59313-58-5) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: oxiran-2-ylmethyl 4-tert-butylbenzoate. InChIKey: NOWVDELPZQQGIG-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | oxiran-2-ylmethyl 4-tert-butylbenzoate |
| InChIKey | NOWVDELPZQQGIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)OCC2CO2 |
Computed by PubChem (NCBI)
Synonyms:
Glycidyl 4-tert-Butylbenzoate, oxiran-2-ylmethyl 4-(tert-butyl)benzoate, oxiran-2-ylmethyl 4-tert-butylbenzoate, 4-tert-Butylbenzoic Acid Glycidyl Ester, (oxiran-2-yl)methyl 4-tert-butylbenzoate, glycidyl p-t-butylbenzoate, 2,3-Epoxypropyl p-tert-butylbenzoate, 2-Oxiranylmethyl 4-tert-butylbenzoate #