CAS 120703-45-9 appears in our catalog under these names: 4-Propanoylphenyl 2,2-dimethylpropanoate, 97%, 4–Propanoylphenyl 2,2–dimethylpropanoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 250mg, 1g.
(4-propanoylphenyl) 2,2-dimethylpropanoate (CAS 120703-45-9) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: (4-propanoylphenyl) 2,2-dimethylpropanoate. InChIKey: CZDYREYTQIPCTK-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | (4-propanoylphenyl) 2,2-dimethylpropanoate |
| InChIKey | CZDYREYTQIPCTK-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)OC(=O)C(C)(C)C |
Computed by PubChem (NCBI)