Products 500892-07-9
CAS 500892-07-9 appears in our catalog under these names: 5-Oxo-5-(2,4,6-trimethylphenyl)pentanoic acid, 95%, 5-(2,4,6-Trimethylphenyl)-5-oxovaleric acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-oxo-5-(2,4,6-trimethylphenyl)pentanoic acid (CAS 500892-07-9) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 5-oxo-5-(2,4,6-trimethylphenyl)pentanoic acid. InChIKey: ZEMMDCNECWHBGE-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 5-oxo-5-(2,4,6-trimethylphenyl)pentanoic acid |
| InChIKey | ZEMMDCNECWHBGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)CCCC(=O)O)C |
Computed by PubChem (NCBI)