cas: 213462-19-2 — see every product listed under this CAS number, including other names
4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine, 95% (CAS 213462-19-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F518991-100MG |
| cas | 213462-19-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2720.93 Pln | |
| Fluorochem | 250mg | 4293.30 Pln | |
| Fluorochem | 500mg | 6797.62 Pln | |
| Fluorochem | 1g | 10811.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CAS 213462-19-2) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine. InChIKey: YZMKEDMYYJQGRD-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| InChIKey | YZMKEDMYYJQGRD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C3=C(CCN2)SC=C3 |
Computed by PubChem (NCBI)