CAS 796999-35-4 is the registry number for 2-((3,4-Dimethylphenyl)thio)-1-(1H-pyrrol-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethylphenyl)sulfanyl-1-(1H-pyrrol-2-yl)ethanone (CAS 796999-35-4) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)sulfanyl-1-(1H-pyrrol-2-yl)ethanone. InChIKey: XBSKIMVVSIVCNM-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)sulfanyl-1-(1H-pyrrol-2-yl)ethanone |
| InChIKey | XBSKIMVVSIVCNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)SCC(=O)C2=CC=CN2)C |
Computed by PubChem (NCBI)