CAS 930843-74-6 is the registry number for 1-(2-(2,4-Dimethylphenyl)-4-methylthiazol-5-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 930843-74-6) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: 1-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: JESSISKDUHVKMQ-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | 1-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | JESSISKDUHVKMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC(=C(S2)C(=O)C)C)C |
Computed by PubChem (NCBI)