CAS 930906-47-1 is the registry number for N-Benzyl-2,5-dimethylthiophene-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-2,5-dimethylthiophene-3-carboxamide (CAS 930906-47-1) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: N-benzyl-2,5-dimethylthiophene-3-carboxamide. InChIKey: HIPNCZGOTHFAAO-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | N-benzyl-2,5-dimethylthiophene-3-carboxamide |
| InChIKey | HIPNCZGOTHFAAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C(=O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)