CAS 67113-91-1 is the registry number for Dibenzyl(imino)-λ6-sulfanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Dibenzyl-imino-oxo-lambda6-sulfane (CAS 67113-91-1) is a chemical compound with the molecular formula C14H15NOS and a molecular weight of 245.34 g/mol. IUPAC name: dibenzyl-imino-oxo-lambda6-sulfane. InChIKey: PQEQYIQDYKTOFZ-UHFFFAOYSA-N.
| Molecular formula | C14H15NOS |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | dibenzyl-imino-oxo-lambda6-sulfane |
| InChIKey | PQEQYIQDYKTOFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=N)(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)