cas: 71002-88-5 — see every product listed under this CAS number, including other names
4-(5-Nitrobenzimidazol-2-yl)aniline, >97%, >97% (CAS 71002-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K6F-100mg |
| cas | 71002-88-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1024.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-(6-nitro-1H-benzimidazol-2-yl)aniline (CAS 71002-88-5) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 4-(6-nitro-1H-benzimidazol-2-yl)aniline. InChIKey: VQAXRPAGHNBDHU-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O2 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 4-(6-nitro-1H-benzimidazol-2-yl)aniline |
| InChIKey | VQAXRPAGHNBDHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-])N |
Computed by PubChem (NCBI)