CAS 309944-73-8 appears in our catalog under these names: 5-Nitro-1-phenyl-1h-indazol-3-amine, 95%, 5-Nitro-1-phenyl-1H-indazol-3-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g.
5-nitro-1-phenylindazol-3-amine (CAS 309944-73-8) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 5-nitro-1-phenylindazol-3-amine. InChIKey: INDGFGKXFJXUMW-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O2 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-nitro-1-phenylindazol-3-amine |
| InChIKey | INDGFGKXFJXUMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)[N+](=O)[O-])C(=N2)N |
Computed by PubChem (NCBI)