CAS 1707394-68-0 is the registry number for 1-Phenyl-5-(1h-pyrrol-1-yl)-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid (CAS 1707394-68-0) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid. InChIKey: YUUMEDQTPDKIQV-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O2 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid |
| InChIKey | YUUMEDQTPDKIQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(N=N2)C(=O)O)N3C=CC=C3 |
Computed by PubChem (NCBI)