Products 1707394-68-0

CAS 1707394-68-0 is the registry number for 1-Phenyl-5-(1h-pyrrol-1-yl)-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid (CAS 1707394-68-0) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid. InChIKey: YUUMEDQTPDKIQV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10N4O2
Molecular weight254.24 g/mol
IUPAC name1-phenyl-5-pyrrol-1-yltriazole-4-carboxylic acid
InChIKeyYUUMEDQTPDKIQV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=C(N=N2)C(=O)O)N3C=CC=C3

Computed by PubChem (NCBI)