CAS 1707085-15-1 is the registry number for 5-Methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 1707085-15-1) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: YVWGHPSOWCVNNY-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O2 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | YVWGHPSOWCVNNY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)