CAS 1018125-61-5 appears in our catalog under these names: 7-(p-Tolyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid, 97%, 97%, 7-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
7-(4-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 1018125-61-5) is a chemical compound with the molecular formula C13H10N4O2 and a molecular weight of 254.24 g/mol. IUPAC name: 7-(4-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: FANUHTHOFQXEBM-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O2 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 7-(4-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | FANUHTHOFQXEBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=NC3=NC(=NN23)C(=O)O |
Computed by PubChem (NCBI)