cas: 886362-14-7 — see every product listed under this CAS number, including other names
4-(5-Oxazolyl)benzohydrazide, ≥95%, ≥95% (CAS 886362-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K6H-100mg |
| cas | 886362-14-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 1g | 861.20 Pln | |
| Chemat | 5g | 1850.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-(1,3-oxazol-5-yl)benzohydrazide (CAS 886362-14-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-(1,3-oxazol-5-yl)benzohydrazide. InChIKey: ZHYJVYAAIVMXIW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(1,3-oxazol-5-yl)benzohydrazide |
| InChIKey | ZHYJVYAAIVMXIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CO2)C(=O)NN |
Computed by PubChem (NCBI)