cas: 83883-25-4 — see every product listed under this CAS number, including other names
4-(6-HYDROXYHEXYLOXY)BENZOIC ACID, 98% (CAS 83883-25-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F792272-1G |
| cas | 83883-25-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 883.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(6-hydroxyhexoxy)benzoic acid (CAS 83883-25-4) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 4-(6-hydroxyhexoxy)benzoic acid. InChIKey: VVYHWYFUTOHXRH-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 4-(6-hydroxyhexoxy)benzoic acid |
| InChIKey | VVYHWYFUTOHXRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCCCCCO |
Computed by PubChem (NCBI)