cas: 83883-25-4 — see every product listed under this CAS number, including other names
4-(6-Hydroxyhexyloxy)benzoic Acid, >97.0%(GC) (CAS 83883-25-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H1629-1G |
| cas | 83883-25-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 270.78 Pln | |
| TCI | 5g | 816.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
4-(6-hydroxyhexoxy)benzoic acid (CAS 83883-25-4) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 4-(6-hydroxyhexoxy)benzoic acid. InChIKey: VVYHWYFUTOHXRH-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 4-(6-hydroxyhexoxy)benzoic acid |
| InChIKey | VVYHWYFUTOHXRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCCCCCO |
Computed by PubChem (NCBI)