CAS 1345866-66-1 appears in our catalog under these names: (Me)Tz-benzoic acid, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)benzoic acid, 98%, 98%, 4-(6-METHYL-1,2,4,5-TETRAZIN-3-YL)BENZOIC ACID, 98%, 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)benzoic acid, 97%. Offered by: Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg, 5g.
4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoic acid (CAS 1345866-66-1) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoic acid. InChIKey: VIRCHPVFFZGAJH-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoic acid |
| InChIKey | VIRCHPVFFZGAJH-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)