CAS 1235438-85-3 is the registry number for 1-(2-Azidoethyl)-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(2-azidoethyl)indole-2,3-dione (CAS 1235438-85-3) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 1-(2-azidoethyl)indole-2,3-dione. InChIKey: RDUCNPFDDNUGSM-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 1-(2-azidoethyl)indole-2,3-dione |
| InChIKey | RDUCNPFDDNUGSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CCN=[N+]=[N-] |
Computed by PubChem (NCBI)