CAS 840473-62-3 is the registry number for 6-Oxo-N-(pyridin-4-yl)-1,6-dihydropyridazine-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-N-pyridin-4-yl-1H-pyridazine-3-carboxamide (CAS 840473-62-3) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 6-oxo-N-pyridin-4-yl-1H-pyridazine-3-carboxamide. InChIKey: ODLTVGNQJCXNSH-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 6-oxo-N-pyridin-4-yl-1H-pyridazine-3-carboxamide |
| InChIKey | ODLTVGNQJCXNSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NN=C1C(=O)NC2=CC=NC=C2 |
Computed by PubChem (NCBI)