CAS 30250-66-9 is the registry number for 2-(2-azidoethyl)-1H-isoindole-1,3(2H)-dione. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(2-azidoethyl)isoindole-1,3-dione (CAS 30250-66-9) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 2-(2-azidoethyl)isoindole-1,3-dione. InChIKey: WHYPSHDXYZFTHJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 2-(2-azidoethyl)isoindole-1,3-dione |
| InChIKey | WHYPSHDXYZFTHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)