Products 2361703-56-0

CAS 2361703-56-0 is the registry number for 3-(3-Amino-1,2,4-triazin-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(3-amino-1,2,4-triazin-5-yl)benzoic acid (CAS 2361703-56-0) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 3-(3-amino-1,2,4-triazin-5-yl)benzoic acid. InChIKey: LAQGXKRABZRXFT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N4O2
Molecular weight216.20 g/mol
IUPAC name3-(3-amino-1,2,4-triazin-5-yl)benzoic acid
InChIKeyLAQGXKRABZRXFT-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CN=NC(=N2)N

Computed by PubChem (NCBI)