cas: 1523618-21-4 — see every product listed under this CAS number, including other names
4-(BOC-AMINOMETHYL)-4-METHYLPIPERIDINE HCL, 98% (CAS 1523618-21-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468011-100MG |
| cas | 1523618-21-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 955.93 Pln | |
| Fluorochem | 5g | 2903.16 Pln | |
| Fluorochem | 10g | 5745.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride (CAS 1523618-21-4) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride. InChIKey: HSUPLVYPVUYJAO-UHFFFAOYSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride |
| InChIKey | HSUPLVYPVUYJAO-UHFFFAOYSA-N |
| SMILES | CC1(CCNCC1)CNC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)