CAS 955979-06-3 appears in our catalog under these names: (R)-tert-Butyl 2-isopropylpiperazine-1-carboxylate hydrochloride, 95%, (R)–tert–Butyl 2–isopropylpiperazine–1–carboxylate hydrochloride, (R)-tert-Butyl 2-isopropylpiperazine-1-carboxylate hydrochloride 95%, (R)-tert-Butyl 2-isopropylpiperazine-1-carboxylate hydrochloride, 95%, 95%, (R)-1-Boc-2-Isopropylpiperazine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
Tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride (CAS 955979-06-3) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride. InChIKey: ILEMLVIGGJLCHC-PPHPATTJSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl (2R)-2-propan-2-ylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ILEMLVIGGJLCHC-PPHPATTJSA-N |
| SMILES | CC(C)[C@@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)