Products 202979-32-6

CAS 202979-32-6 is the registry number for 4-(2-Aminoethyl)-1-BOC-piperidine hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;hydrochloride (CAS 202979-32-6) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;hydrochloride. InChIKey: BZYIDGCFSSFZLS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H25ClN2O2
Molecular weight264.79 g/mol
IUPAC nametert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;hydrochloride
InChIKeyBZYIDGCFSSFZLS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CCN.Cl

Computed by PubChem (NCBI)