Products 1393441-75-2

CAS 1393441-75-2 is the registry number for t-Butyl trans-4-Aminocyclohexylmethylcarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(4-aminocyclohexyl)methyl]carbamate;hydrochloride (CAS 1393441-75-2) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl N-[(4-aminocyclohexyl)methyl]carbamate;hydrochloride. InChIKey: WYCYTOTYWLOWSV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H25ClN2O2
Molecular weight264.79 g/mol
IUPAC nametert-butyl N-[(4-aminocyclohexyl)methyl]carbamate;hydrochloride
InChIKeyWYCYTOTYWLOWSV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1CCC(CC1)N.Cl

Computed by PubChem (NCBI)