CAS 1523618-21-4 appears in our catalog under these names: 4-(Boc-aminomethyl)-4-methylpiperidine hydrochloride, 95%, 4-(BOC-AMINOMETHYL)-4-METHYLPIPERIDINE HCL, 98%, tert-Butyl ((4-methylpiperidin-4-yl)methyl)carbamate hydrochloride, 97%, Carbamic acid, N-[(4-methyl-4-piperidinyl)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1), 98%, 98%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
Tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride (CAS 1523618-21-4) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride. InChIKey: HSUPLVYPVUYJAO-UHFFFAOYSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl N-[(4-methylpiperidin-4-yl)methyl]carbamate;hydrochloride |
| InChIKey | HSUPLVYPVUYJAO-UHFFFAOYSA-N |
| SMILES | CC1(CCNCC1)CNC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)