cas: 20934-81-0 — see every product listed under this CAS number, including other names
4-(Benzo[d]oxazol-2-yl)aniline, 99.93% (CAS 20934-81-0) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 25 g, 5 g, 10 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W029411-1 g |
| cas | 20934-81-0 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 25 g | 1606.08 Pln | |
| MedChemExpress | 5 g | 505.45 Pln | |
| MedChemExpress | 10 g | 793.38 Pln | |
| MedChemExpress | 10mM/1mL | 384.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.93% |
4-(1,3-benzoxazol-2-yl)aniline (CAS 20934-81-0) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 4-(1,3-benzoxazol-2-yl)aniline. InChIKey: XZYQBYQGHHGXBC-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-(1,3-benzoxazol-2-yl)aniline |
| InChIKey | XZYQBYQGHHGXBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)